C9H8O — CID 54422716
(2-ethenylcyclohexa-2,4-dien-1-ylidene)methanone (PubChem CID 54422716) has the molecular formula C9H8O and a molecular weight of 132.16 g/mol. Its IUPAC name is (2-ethenylcyclohexa-2,4-dien-1-ylidene)methanone.
| Compound Name | (2-ethenylcyclohexa-2,4-dien-1-ylidene)methanone |
|---|---|
| PubChem CID | 54422716 |
| Molecular Formula | C9H8O |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | (2-ethenylcyclohexa-2,4-dien-1-ylidene)methanone |
| SMILES | C=CC1=CC=CCC1=C=O |
| InChI | InChI=1S/C9H8O/c1-2-8-5-3-4-6-9(8)7-10/h2-5H,1,6H2 |
| InChIKey | FVWPOCINJPNHNX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|