C12H14ClZr- — CID 87133400
1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium;hydrochloride (PubChem CID 87133400) has the molecular formula C12H14ClZr- and a molecular weight of 284.92 g/mol. Its IUPAC name is 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium;hydrochloride.
| Compound Name | 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium;hydrochloride |
|---|---|
| PubChem CID | 87133400 |
| Molecular Formula | C12H14ClZr- |
| Molecular Weight | 284.92 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium;hydrochloride |
| SMILES | C[C-](C1=CC=CC1)C1=CC=CC1.Cl.[Zr] |
| InChI | InChI=1S/C12H13.ClH.Zr/c1-10(11-6-2-3-7-11)12-8-4-5-9-12;;/h2-6,8H,7,9H2,1H3;1H;/q-1;; |
| InChIKey | RHBBFXDQGVDNIX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|