C17H15B — CID 15791983
cyclopenta-1,3-dien-1-yl(diphenyl)borane (PubChem CID 15791983) has the molecular formula C17H15B and a molecular weight of 230.12 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl(diphenyl)borane.
| Compound Name | cyclopenta-1,3-dien-1-yl(diphenyl)borane |
|---|---|
| PubChem CID | 15791983 |
| Molecular Formula | C17H15B |
| Molecular Weight | 230.12 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl(diphenyl)borane |
| SMILES | C1=CCC(B(c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C17H15B/c1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16/h1-13H,14H2 |
| InChIKey | KOAZOZWTIBGXCY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.12 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|