C25H30F3N3O2 — CID 173316646
5-(2-aminoethoxyimino)-5-phenyl-4-piperidin-1-yl-1-[4-(trifluoromethyl)phenyl]pentan-1-one (PubChem CID 173316646) has the molecular formula C25H30F3N3O2 and a molecular weight of 461.53 g/mol. Its IUPAC name is 5-(2-aminoethoxyimino)-5-phenyl-4-piperidin-1-yl-1-[4-(trifluoromethyl)phenyl]pentan-1-one.
| Compound Name | 5-(2-aminoethoxyimino)-5-phenyl-4-piperidin-1-yl-1-[4-(trifluoromethyl)phenyl]pentan-1-one |
|---|---|
| PubChem CID | 173316646 |
| Molecular Formula | C25H30F3N3O2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 5-(2-aminoethoxyimino)-5-phenyl-4-piperidin-1-yl-1-[4-(trifluoromethyl)phenyl]pentan-1-one |
| SMILES | NCCON=C(c1ccccc1)C(CCC(=O)c1ccc(C(F)(F)F)cc1)N1CCCCC1 |
| InChI | InChI=1S/C25H30F3N3O2/c26-25(27,28)21-11-9-19(10-12-21)23(32)14-13-22(31-16-5-2-6-17-31)24(30-33-18-15-29)20-7-3-1-4-8-20/h1,3-4,7-12,22H,2,5-6,13-18,29H2 |
| InChIKey | TXDDGDPDNHTCMO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|