C24H31N3O2 — CID 173316796
5-(2-aminoethoxyimino)-1,5-diphenyl-4-piperidin-1-ylpentan-1-one (PubChem CID 173316796) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 5-(2-aminoethoxyimino)-1,5-diphenyl-4-piperidin-1-ylpentan-1-one.
| Compound Name | 5-(2-aminoethoxyimino)-1,5-diphenyl-4-piperidin-1-ylpentan-1-one |
|---|---|
| PubChem CID | 173316796 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 5-(2-aminoethoxyimino)-1,5-diphenyl-4-piperidin-1-ylpentan-1-one |
| SMILES | NCCON=C(c1ccccc1)C(CCC(=O)c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C24H31N3O2/c25-16-19-29-26-24(21-12-6-2-7-13-21)22(27-17-8-3-9-18-27)14-15-23(28)20-10-4-1-5-11-20/h1-2,4-7,10-13,22H,3,8-9,14-19,25H2 |
| InChIKey | YEMFOTFQYKSRIA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|