About methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide
methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide (PubChem CID 173321346) has the molecular formula C17H36BrO2P
and a molecular weight of 383.35 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide.
Molecular Properties
| Compound Name | methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide |
| PubChem CID | 173321346 |
| Molecular Formula | C17H36BrO2P |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide |
| SMILES | Br.C=C(C)C(=O)OC.CCCCP(CCCC)CCCC |
| InChI | InChI=1S/C12H27P.C5H8O2.BrH/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-4(2)5(6)7-3;/h4-12H2,1-3H3;1H2,2-3H3;1H |
| InChIKey | KGSBVCOUGSWDCJ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide?
The IUPAC name of methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide (CID 173321346) is methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide.
What is the SMILES notation for methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide?
The canonical SMILES for methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide is Br.C=C(C)C(=O)OC.CCCCP(CCCC)CCCC.
What is the InChIKey of methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide?
The InChIKey is KGSBVCOUGSWDCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P.C5H8O2.BrH/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-4(2)5(6)7-3;/h4-12H2,1-3H3;1H2,2-3H3;1H.
What are the key properties of methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide?
methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide has a molecular weight of 383.35 g/mol, XLogP of 6.18, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylprop-2-enoate;tributylphosphane;hydrobromide is sourced from PubChem (CID 173321346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).