C16H23NO6S — CID 173323800
2-methoxyethyl (3R,4S,5S)-3,4-dihydroxy-2-(hydroxymethyl)-5-phenylsulfanylpiperidine-1-carboxylate (PubChem CID 173323800) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-methoxyethyl (3R,4S,5S)-3,4-dihydroxy-2-(hydroxymethyl)-5-phenylsulfanylpiperidine-1-carboxylate.
| Compound Name | 2-methoxyethyl (3R,4S,5S)-3,4-dihydroxy-2-(hydroxymethyl)-5-phenylsulfanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 173323800 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-methoxyethyl (3R,4S,5S)-3,4-dihydroxy-2-(hydroxymethyl)-5-phenylsulfanylpiperidine-1-carboxylate |
| SMILES | COCCOC(=O)N1C[C@H](Sc2ccccc2)[C@@H](O)[C@H](O)C1CO |
| InChI | InChI=1S/C16H23NO6S/c1-22-7-8-23-16(21)17-9-13(15(20)14(19)12(17)10-18)24-11-5-3-2-4-6-11/h2-6,12-15,18-20H,7-10H2,1H3/t12?,13-,14+,15+/m0/s1 |
| InChIKey | FMZWMMABYPPJFG-FGDMXMHKSA-N |
| XLogP | 0.33 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|