C14H24OSi — CID 173325081
butyl-[2-(1,4-dimethylcyclohexa-2,4-dien-1-yl)ethenoxy]silane (PubChem CID 173325081) has the molecular formula C14H24OSi and a molecular weight of 236.43 g/mol. Its IUPAC name is butyl-[2-(1,4-dimethylcyclohexa-2,4-dien-1-yl)ethenoxy]silane.
| Compound Name | butyl-[2-(1,4-dimethylcyclohexa-2,4-dien-1-yl)ethenoxy]silane |
|---|---|
| PubChem CID | 173325081 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | butyl-[2-(1,4-dimethylcyclohexa-2,4-dien-1-yl)ethenoxy]silane |
| SMILES | CCCC[SiH2]OC=CC1(C)C=CC(C)=CC1 |
| InChI | InChI=1S/C14H24OSi/c1-4-5-12-16-15-11-10-14(3)8-6-13(2)7-9-14/h6-8,10-11H,4-5,9,12,16H2,1-3H3 |
| InChIKey | UDOXQEASHCDCGA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|