C15H24N4O4 — CID 173326018
1-[1-[carbamoyl(2-hydroxyethyl)amino]-1-phenylpropyl]-1-(2-hydroxyethyl)urea (PubChem CID 173326018) has the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-[1-[carbamoyl(2-hydroxyethyl)amino]-1-phenylpropyl]-1-(2-hydroxyethyl)urea.
| Compound Name | 1-[1-[carbamoyl(2-hydroxyethyl)amino]-1-phenylpropyl]-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 173326018 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-[1-[carbamoyl(2-hydroxyethyl)amino]-1-phenylpropyl]-1-(2-hydroxyethyl)urea |
| SMILES | CCC(c1ccccc1)(N(CCO)C(N)=O)N(CCO)C(N)=O |
| InChI | InChI=1S/C15H24N4O4/c1-2-15(12-6-4-3-5-7-12,18(8-10-20)13(16)22)19(9-11-21)14(17)23/h3-7,20-21H,2,8-11H2,1H3,(H2,16,22)(H2,17,23) |
| InChIKey | VKKBLCRECDYLOP-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|