C56H56N4O8 — CID 173328600
bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-4-(4-methoxyphenyl)piperazine);but-2-enedioic acid (PubChem CID 173328600) has the molecular formula C56H56N4O8 and a molecular weight of 913.08 g/mol. Its IUPAC name is bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-4-(4-methoxyphenyl)piperazine);but-2-enedioic acid.
| Compound Name | bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-4-(4-methoxyphenyl)piperazine);but-2-enedioic acid |
|---|---|
| PubChem CID | 173328600 |
| Molecular Formula | C56H56N4O8 |
| Molecular Weight | 913.08 g/mol |
| Exact Mass | 912.41 |
| IUPAC Name | bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-4-(4-methoxyphenyl)piperazine);but-2-enedioic acid |
| SMILES | COc1ccc(N2CCN(CC3=Cc4ccccc4Oc4ccccc43)CC2)cc1.COc1ccc(N2CCN(CC3=Cc4ccccc4Oc4ccccc43)CC2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/2C26H26N2O2.C4H4O4/c2*1-29-23-12-10-22(11-13-23)28-16-14-27(15-17-28)19-21-18-20-6-2-4-8-25(20)30-26-9-5-3-7-24(21)26;5-3(6)1-2-4(7)8/h2*2-13,18H,14-17,19H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | VLORGKBAWRAMLP-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.08 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|