C38H52O6 — CID 173329726
dibutyl (4R,5R)-2-phenyl-2-[2-(4-phenyl-1-propylcyclohexyl)but-3-enyl]-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 173329726) has the molecular formula C38H52O6 and a molecular weight of 604.83 g/mol. Its IUPAC name is dibutyl (4R,5R)-2-phenyl-2-[2-(4-phenyl-1-propylcyclohexyl)but-3-enyl]-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | dibutyl (4R,5R)-2-phenyl-2-[2-(4-phenyl-1-propylcyclohexyl)but-3-enyl]-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 173329726 |
| Molecular Formula | C38H52O6 |
| Molecular Weight | 604.83 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | dibutyl (4R,5R)-2-phenyl-2-[2-(4-phenyl-1-propylcyclohexyl)but-3-enyl]-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | C=CC(CC1(c2ccccc2)O[C@@H](C(=O)OCCCC)[C@H](C(=O)OCCCC)O1)C1(CCC)CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C38H52O6/c1-5-9-26-41-35(39)33-34(36(40)42-27-10-6-2)44-38(43-33,32-19-15-12-16-20-32)28-31(8-4)37(23-7-3)24-21-30(22-25-37)29-17-13-11-14-18-29/h8,11-20,30-31,33-34H,4-7,9-10,21-28H2,1-3H3/t30?,31?,33-,34-,37?/m1/s1 |
| InChIKey | IAJVTWFECXMLNI-VLFAWGHBSA-N |
| XLogP | 8.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.83 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|