C36H48O6 — CID 173329737
diethyl (4R,5R)-2-[2-(1-pentyl-4-phenylcyclohexyl)but-3-enyl]-2-phenyl-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 173329737) has the molecular formula C36H48O6 and a molecular weight of 576.77 g/mol. Its IUPAC name is diethyl (4R,5R)-2-[2-(1-pentyl-4-phenylcyclohexyl)but-3-enyl]-2-phenyl-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | diethyl (4R,5R)-2-[2-(1-pentyl-4-phenylcyclohexyl)but-3-enyl]-2-phenyl-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 173329737 |
| Molecular Formula | C36H48O6 |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | diethyl (4R,5R)-2-[2-(1-pentyl-4-phenylcyclohexyl)but-3-enyl]-2-phenyl-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | C=CC(CC1(c2ccccc2)O[C@@H](C(=O)OCC)[C@H](C(=O)OCC)O1)C1(CCCCC)CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C36H48O6/c1-5-9-16-23-35(24-21-28(22-25-35)27-17-12-10-13-18-27)29(6-2)26-36(30-19-14-11-15-20-30)41-31(33(37)39-7-3)32(42-36)34(38)40-8-4/h6,10-15,17-20,28-29,31-32H,2,5,7-9,16,21-26H2,1,3-4H3/t28?,29?,31-,32-,35?/m1/s1 |
| InChIKey | RTJUOQUQLCYROG-FXWXLENXSA-N |
| XLogP | 7.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|