C24H41ClO5PS+ — CID 173330512
3-[(2R,3S)-3-[5-(4-chlorophenoxy)pentylsulfanyl]decan-2-yl]oxypropoxy-hydroxy-oxophosphanium (PubChem CID 173330512) has the molecular formula C24H41ClO5PS+ and a molecular weight of 508.08 g/mol. Its IUPAC name is 3-[(2R,3S)-3-[5-(4-chlorophenoxy)pentylsulfanyl]decan-2-yl]oxypropoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[(2R,3S)-3-[5-(4-chlorophenoxy)pentylsulfanyl]decan-2-yl]oxypropoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 173330512 |
| Molecular Formula | C24H41ClO5PS+ |
| Molecular Weight | 508.08 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 3-[(2R,3S)-3-[5-(4-chlorophenoxy)pentylsulfanyl]decan-2-yl]oxypropoxy-hydroxy-oxophosphanium |
| SMILES | CCCCCCC[C@H](SCCCCCOc1ccc(Cl)cc1)[C@@H](C)OCCCO[P+](=O)O |
| InChI | InChI=1S/C24H40ClO5PS/c1-3-4-5-6-8-12-24(21(2)28-18-11-19-30-31(26)27)32-20-10-7-9-17-29-23-15-13-22(25)14-16-23/h13-16,21,24H,3-12,17-20H2,1-2H3/p+1/t21-,24+/m1/s1 |
| InChIKey | SDHVLHXBYUPZHI-QPPBQGQZSA-O |
| XLogP | 7.81 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.08 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|