C27H44ClO7PS — CID 139831059
3-[3-[3-(4-chlorophenoxy)-10-pentylsulfanyldecan-2-yl]oxypropoxy]-2-hydroxy-2-phosphorosopropanoic acid (PubChem CID 139831059) has the molecular formula C27H44ClO7PS and a molecular weight of 579.14 g/mol. Its IUPAC name is 3-[3-[3-(4-chlorophenoxy)-10-pentylsulfanyldecan-2-yl]oxypropoxy]-2-hydroxy-2-phosphorosopropanoic acid.
| Compound Name | 3-[3-[3-(4-chlorophenoxy)-10-pentylsulfanyldecan-2-yl]oxypropoxy]-2-hydroxy-2-phosphorosopropanoic acid |
|---|---|
| PubChem CID | 139831059 |
| Molecular Formula | C27H44ClO7PS |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 3-[3-[3-(4-chlorophenoxy)-10-pentylsulfanyldecan-2-yl]oxypropoxy]-2-hydroxy-2-phosphorosopropanoic acid |
| SMILES | CCCCCSCCCCCCCC(Oc1ccc(Cl)cc1)C(C)OCCCOCC(O)(P=O)C(=O)O |
| InChI | InChI=1S/C27H44ClO7PS/c1-3-4-9-19-37-20-10-7-5-6-8-12-25(35-24-15-13-23(28)14-16-24)22(2)34-18-11-17-33-21-27(31,36-32)26(29)30/h13-16,22,25,31H,3-12,17-21H2,1-2H3,(H,29,30) |
| InChIKey | ZZXSCIXWTNCWAE-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|