C28H48O7PS+ — CID 150903647
[1-carboxy-1-hydroxy-2-[3-[10-(3-phenoxyhexylsulfanyl)decan-2-yloxy]propoxy]ethyl]-oxophosphanium (PubChem CID 150903647) has the molecular formula C28H48O7PS+ and a molecular weight of 559.73 g/mol. Its IUPAC name is [1-carboxy-1-hydroxy-2-[3-[10-(3-phenoxyhexylsulfanyl)decan-2-yloxy]propoxy]ethyl]-oxophosphanium.
| Compound Name | [1-carboxy-1-hydroxy-2-[3-[10-(3-phenoxyhexylsulfanyl)decan-2-yloxy]propoxy]ethyl]-oxophosphanium |
|---|---|
| PubChem CID | 150903647 |
| Molecular Formula | C28H48O7PS+ |
| Molecular Weight | 559.73 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | [1-carboxy-1-hydroxy-2-[3-[10-(3-phenoxyhexylsulfanyl)decan-2-yloxy]propoxy]ethyl]-oxophosphanium |
| SMILES | CCCC(CCSCCCCCCCCC(C)OCCCOCC(O)([PH+]=O)C(=O)O)Oc1ccccc1 |
| InChI | InChI=1S/C28H47O7PS/c1-3-14-25(35-26-16-10-8-11-17-26)18-22-37-21-12-7-5-4-6-9-15-24(2)34-20-13-19-33-23-28(31,36-32)27(29)30/h8,10-11,16-17,24-25,31H,3-7,9,12-15,18-23H2,1-2H3,(H,29,30)/p+1 |
| InChIKey | LANHWEMKTOZENG-UHFFFAOYSA-O |
| XLogP | 6.70 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.73 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|