C32H57O7PS — CID 140991791
[3-(4-tert-butylphenoxy)-10-octylsulfanyldecan-2-yl]oxy-propylperoxycarbonylphosphinic acid (PubChem CID 140991791) has the molecular formula C32H57O7PS and a molecular weight of 616.84 g/mol. Its IUPAC name is [3-(4-tert-butylphenoxy)-10-octylsulfanyldecan-2-yl]oxy-propylperoxycarbonylphosphinic acid.
| Compound Name | [3-(4-tert-butylphenoxy)-10-octylsulfanyldecan-2-yl]oxy-propylperoxycarbonylphosphinic acid |
|---|---|
| PubChem CID | 140991791 |
| Molecular Formula | C32H57O7PS |
| Molecular Weight | 616.84 g/mol |
| Exact Mass | 616.36 |
| IUPAC Name | [3-(4-tert-butylphenoxy)-10-octylsulfanyldecan-2-yl]oxy-propylperoxycarbonylphosphinic acid |
| SMILES | CCCCCCCCSCCCCCCCC(Oc1ccc(C(C)(C)C)cc1)C(C)OP(=O)(O)C(=O)OOCCC |
| InChI | InChI=1S/C32H57O7PS/c1-7-9-10-11-14-17-25-41-26-18-15-12-13-16-19-30(37-29-22-20-28(21-23-29)32(4,5)6)27(3)39-40(34,35)31(33)38-36-24-8-2/h20-23,27,30H,7-19,24-26H2,1-6H3,(H,34,35) |
| InChIKey | BINDBGCFZWERIE-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.84 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|