C32H57O6PS — CID 151015574
[10-[3-(4-tert-butylphenyl)octylsulfanyl]decan-2-ylperoxy-propoxyphosphoryl]formic acid (PubChem CID 151015574) has the molecular formula C32H57O6PS and a molecular weight of 600.84 g/mol. Its IUPAC name is [10-[3-(4-tert-butylphenyl)octylsulfanyl]decan-2-ylperoxy-propoxyphosphoryl]formic acid.
| Compound Name | [10-[3-(4-tert-butylphenyl)octylsulfanyl]decan-2-ylperoxy-propoxyphosphoryl]formic acid |
|---|---|
| PubChem CID | 151015574 |
| Molecular Formula | C32H57O6PS |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.36 |
| IUPAC Name | [10-[3-(4-tert-butylphenyl)octylsulfanyl]decan-2-ylperoxy-propoxyphosphoryl]formic acid |
| SMILES | CCCCCC(CCSCCCCCCCCC(C)OOP(=O)(OCCC)C(=O)O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H57O6PS/c1-7-9-14-18-28(29-19-21-30(22-20-29)32(4,5)6)23-26-40-25-16-13-11-10-12-15-17-27(3)37-38-39(35,31(33)34)36-24-8-2/h19-22,27-28H,7-18,23-26H2,1-6H3,(H,33,34) |
| InChIKey | LWZQLBXOFWXZJM-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|