C31H61O6PS — CID 140991785
2-[10-(3-cycloheptyloctylsulfanyl)decan-2-yloxy-hydroxyphosphoryl]-2-propoxypropanoic acid (PubChem CID 140991785) has the molecular formula C31H61O6PS and a molecular weight of 592.86 g/mol. Its IUPAC name is 2-[10-(3-cycloheptyloctylsulfanyl)decan-2-yloxy-hydroxyphosphoryl]-2-propoxypropanoic acid.
| Compound Name | 2-[10-(3-cycloheptyloctylsulfanyl)decan-2-yloxy-hydroxyphosphoryl]-2-propoxypropanoic acid |
|---|---|
| PubChem CID | 140991785 |
| Molecular Formula | C31H61O6PS |
| Molecular Weight | 592.86 g/mol |
| Exact Mass | 592.39 |
| IUPAC Name | 2-[10-(3-cycloheptyloctylsulfanyl)decan-2-yloxy-hydroxyphosphoryl]-2-propoxypropanoic acid |
| SMILES | CCCCCC(CCSCCCCCCCCC(C)OP(=O)(O)C(C)(OCCC)C(=O)O)C1CCCCCC1 |
| InChI | InChI=1S/C31H61O6PS/c1-5-7-14-20-29(28-21-16-11-12-17-22-28)23-26-39-25-18-13-9-8-10-15-19-27(3)37-38(34,35)31(4,30(32)33)36-24-6-2/h27-29H,5-26H2,1-4H3,(H,32,33)(H,34,35) |
| InChIKey | PWBKUJRXJGTPLA-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.86 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|