C28H42N6O7S — CID 173335120
[4-[[4-[[[(2S)-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]methyl]piperidine-1-carboximidoyl]amino]-4-oxobutyl] acetate (PubChem CID 173335120) has the molecular formula C28H42N6O7S and a molecular weight of 606.75 g/mol. Its IUPAC name is [4-[[4-[[[(2S)-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]methyl]piperidine-1-carboximidoyl]amino]-4-oxobutyl] acetate.
| Compound Name | [4-[[4-[[[(2S)-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]methyl]piperidine-1-carboximidoyl]amino]-4-oxobutyl] acetate |
|---|---|
| PubChem CID | 173335120 |
| Molecular Formula | C28H42N6O7S |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | [4-[[4-[[[(2S)-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]methyl]piperidine-1-carboximidoyl]amino]-4-oxobutyl] acetate |
| SMILES | [H]/N=C(\NC(=O)CCCOC(C)=O)N1CCC(CNC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2ccccc2)NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C28H42N6O7S/c1-20(35)41-17-7-11-25(36)31-28(29)33-15-12-22(13-16-33)19-30-26(37)24-10-6-14-34(24)27(38)23(32-42(2,39)40)18-21-8-4-3-5-9-21/h3-5,8-9,22-24,32H,6-7,10-19H2,1-2H3,(H,30,37)(H2,29,31,36)/t23-,24+/m1/s1 |
| InChIKey | LDSAAZGKAKNEGV-RPWUZVMVSA-N |
| XLogP | 0.36 |
| TPSA | 178.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|