C22H34N6O5S — CID 67768813
(2S)-N-[[1-[(hydroxyhydrazinylidene)methyl]piperidin-4-yl]methyl]-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 67768813) has the molecular formula C22H34N6O5S and a molecular weight of 494.62 g/mol. Its IUPAC name is (2S)-N-[[1-[(hydroxyhydrazinylidene)methyl]piperidin-4-yl]methyl]-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[1-[(hydroxyhydrazinylidene)methyl]piperidin-4-yl]methyl]-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67768813 |
| Molecular Formula | C22H34N6O5S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | (2S)-N-[[1-[(hydroxyhydrazinylidene)methyl]piperidin-4-yl]methyl]-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | CS(=O)(=O)N[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)NCC1CCN(C=NNO)CC1 |
| InChI | InChI=1S/C22H34N6O5S/c1-34(32,33)25-19(14-17-6-3-2-4-7-17)22(30)28-11-5-8-20(28)21(29)23-15-18-9-12-27(13-10-18)16-24-26-31/h2-4,6-7,16,18-20,25-26,31H,5,8-15H2,1H3,(H,23,29)/t19-,20+/m1/s1 |
| InChIKey | OSUPGNRVQVRFJK-UXHICEINSA-N |
| XLogP | -0.11 |
| TPSA | 143.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|