C36H56N6O8S — CID 67747858
[6-[[(hexanoylamino)-[4-[[[(2S)-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]methyl]piperidin-1-yl]methylidene]amino]-6-oxohexyl] acetate (PubChem CID 67747858) has the molecular formula C36H56N6O8S and a molecular weight of 732.94 g/mol. Its IUPAC name is [6-[[(hexanoylamino)-[4-[[[(2S)-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]methyl]piperidin-1-yl]methylidene]amino]-6-oxohexyl] acetate.
| Compound Name | [6-[[(hexanoylamino)-[4-[[[(2S)-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]methyl]piperidin-1-yl]methylidene]amino]-6-oxohexyl] acetate |
|---|---|
| PubChem CID | 67747858 |
| Molecular Formula | C36H56N6O8S |
| Molecular Weight | 732.94 g/mol |
| Exact Mass | 732.39 |
| IUPAC Name | [6-[[(hexanoylamino)-[4-[[[(2S)-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]methyl]piperidin-1-yl]methylidene]amino]-6-oxohexyl] acetate |
| SMILES | CCCCCC(=O)N/C(=N\C(=O)CCCCCOC(C)=O)N1CCC(CNC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2ccccc2)NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C36H56N6O8S/c1-4-5-8-17-32(44)38-36(39-33(45)18-11-7-12-24-50-27(2)43)41-22-19-29(20-23-41)26-37-34(46)31-16-13-21-42(31)35(47)30(40-51(3,48)49)25-28-14-9-6-10-15-28/h6,9-10,14-15,29-31,40H,4-5,7-8,11-13,16-26H2,1-3H3,(H,37,46)(H,38,39,44,45)/t30-,31+/m1/s1 |
| InChIKey | QKDDATFEESQEOK-JSOSNVBQSA-N |
| XLogP | 2.67 |
| TPSA | 183.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.94 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|