C23H36N6O4S — CID 22867969
N-[(1-carbamimidoylpiperidin-4-yl)methyl]-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]piperidine-2-carboxamide (PubChem CID 22867969) has the molecular formula C23H36N6O4S and a molecular weight of 492.65 g/mol. Its IUPAC name is N-[(1-carbamimidoylpiperidin-4-yl)methyl]-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]piperidine-2-carboxamide.
| Compound Name | N-[(1-carbamimidoylpiperidin-4-yl)methyl]-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 22867969 |
| Molecular Formula | C23H36N6O4S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | N-[(1-carbamimidoylpiperidin-4-yl)methyl]-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]piperidine-2-carboxamide |
| SMILES | [H]/N=C(\N)N1CCC(CNC(=O)C2CCCCN2C(=O)[C@@H](Cc2ccccc2)NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C23H36N6O4S/c1-34(32,33)27-19(15-17-7-3-2-4-8-17)22(31)29-12-6-5-9-20(29)21(30)26-16-18-10-13-28(14-11-18)23(24)25/h2-4,7-8,18-20,27H,5-6,9-16H2,1H3,(H3,24,25)(H,26,30)/t19-,20?/m1/s1 |
| InChIKey | WPSRBCFEIYKCRE-FIWHBWSRSA-N |
| XLogP | 0.25 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|