C23H33N7O4S — CID 131719589
(2S)-N-[[1-[(cyanohydrazinylidene)methyl]piperidin-4-yl]methyl]-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 131719589) has the molecular formula C23H33N7O4S and a molecular weight of 503.63 g/mol. Its IUPAC name is (2S)-N-[[1-[(cyanohydrazinylidene)methyl]piperidin-4-yl]methyl]-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[1-[(cyanohydrazinylidene)methyl]piperidin-4-yl]methyl]-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 131719589 |
| Molecular Formula | C23H33N7O4S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | (2S)-N-[[1-[(cyanohydrazinylidene)methyl]piperidin-4-yl]methyl]-1-[(2R)-2-(methanesulfonamido)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | CS(=O)(=O)N[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)NCC1CCN(C=NNC#N)CC1 |
| InChI | InChI=1S/C23H33N7O4S/c1-35(33,34)28-20(14-18-6-3-2-4-7-18)23(32)30-11-5-8-21(30)22(31)25-15-19-9-12-29(13-10-19)17-27-26-16-24/h2-4,6-7,17,19-21,26,28H,5,8-15H2,1H3,(H,25,31)/t20-,21+/m1/s1 |
| InChIKey | PDSTWJWBRSLHBN-RTWAWAEBSA-N |
| XLogP | -0.02 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|