C14H16Cl2N2O4 — CID 173340151
[(1R,3R)-3-(4,5-dichloro-2-nitroanilino)cyclopentyl]methyl acetate (PubChem CID 173340151) has the molecular formula C14H16Cl2N2O4 and a molecular weight of 347.20 g/mol. Its IUPAC name is [(1R,3R)-3-(4,5-dichloro-2-nitroanilino)cyclopentyl]methyl acetate.
| Compound Name | [(1R,3R)-3-(4,5-dichloro-2-nitroanilino)cyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 173340151 |
| Molecular Formula | C14H16Cl2N2O4 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | [(1R,3R)-3-(4,5-dichloro-2-nitroanilino)cyclopentyl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CC[C@@H](Nc2cc(Cl)c(Cl)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C14H16Cl2N2O4/c1-8(19)22-7-9-2-3-10(4-9)17-13-5-11(15)12(16)6-14(13)18(20)21/h5-6,9-10,17H,2-4,7H2,1H3/t9-,10-/m1/s1 |
| InChIKey | HZNPWYLLFUHQFY-NXEZZACHSA-N |
| XLogP | 4.05 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|