C11H12Cl2N2O4 — CID 86748571
(1S,2R,3R)-3-(4,5-dichloro-2-nitroanilino)cyclopentane-1,2-diol (PubChem CID 86748571) has the molecular formula C11H12Cl2N2O4 and a molecular weight of 307.13 g/mol. Its IUPAC name is (1S,2R,3R)-3-(4,5-dichloro-2-nitroanilino)cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R)-3-(4,5-dichloro-2-nitroanilino)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 86748571 |
| Molecular Formula | C11H12Cl2N2O4 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | (1S,2R,3R)-3-(4,5-dichloro-2-nitroanilino)cyclopentane-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1N[C@@H]1CC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H12Cl2N2O4/c12-5-3-8(9(15(18)19)4-6(5)13)14-7-1-2-10(16)11(7)17/h3-4,7,10-11,14,16-17H,1-2H2/t7-,10+,11-/m1/s1 |
| InChIKey | CKUIMFKJIHRRDK-PPKCKEKNSA-N |
| XLogP | 2.20 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|