C22H30O2 — CID 173340893
3-benzyl-1-butan-2-yl-2,4-dimethoxy-5-propan-2-ylbenzene (PubChem CID 173340893) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 3-benzyl-1-butan-2-yl-2,4-dimethoxy-5-propan-2-ylbenzene.
| Compound Name | 3-benzyl-1-butan-2-yl-2,4-dimethoxy-5-propan-2-ylbenzene |
|---|---|
| PubChem CID | 173340893 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 3-benzyl-1-butan-2-yl-2,4-dimethoxy-5-propan-2-ylbenzene |
| SMILES | CCC(C)c1cc(C(C)C)c(OC)c(Cc2ccccc2)c1OC |
| InChI | InChI=1S/C22H30O2/c1-7-16(4)19-14-18(15(2)3)21(23-5)20(22(19)24-6)13-17-11-9-8-10-12-17/h8-12,14-16H,7,13H2,1-6H3 |
| InChIKey | ZTZUCTYIURHCIN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |