C5H7NO3 — CID 173345036
N-[(2S)-1,4-dioxobutan-2-yl]formamide (PubChem CID 173345036) has the molecular formula C5H7NO3 and a molecular weight of 129.11 g/mol. Its IUPAC name is N-[(2S)-1,4-dioxobutan-2-yl]formamide.
| Compound Name | N-[(2S)-1,4-dioxobutan-2-yl]formamide |
|---|---|
| PubChem CID | 173345036 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | N-[(2S)-1,4-dioxobutan-2-yl]formamide |
| SMILES | O=CC[C@@H](C=O)NC=O |
| InChI | InChI=1S/C5H7NO3/c7-2-1-5(3-8)6-4-9/h2-5H,1H2,(H,6,9)/t5-/m0/s1 |
| InChIKey | MHWWJMZZWZXXMD-YFKPBYRVSA-N |
| XLogP | -1.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|