C7H11NO — CID 90777860
N-hexa-1,5-dien-3-ylformamide (PubChem CID 90777860) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is N-hexa-1,5-dien-3-ylformamide.
| Compound Name | N-hexa-1,5-dien-3-ylformamide |
|---|---|
| PubChem CID | 90777860 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | N-hexa-1,5-dien-3-ylformamide |
| SMILES | C=CCC(C=C)NC=O |
| InChI | InChI=1S/C7H11NO/c1-3-5-7(4-2)8-6-9/h3-4,6-7H,1-2,5H2,(H,8,9) |
| InChIKey | IGRTWJXAULNCNZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|