About 2-formamidobut-3-enamide
2-formamidobut-3-enamide (PubChem CID 87210952) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-formamidobut-3-enamide.
Molecular Properties
| Compound Name | 2-formamidobut-3-enamide |
| PubChem CID | 87210952 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 2-formamidobut-3-enamide |
| SMILES | C=CC(NC=O)C(N)=O |
| InChI | InChI=1S/C5H8N2O2/c1-2-4(5(6)9)7-3-8/h2-4H,1H2,(H2,6,9)(H,7,8) |
| InChIKey | MRZANMVUSAZQDO-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-formamidobut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formamidobut-3-enamide?
The IUPAC name of 2-formamidobut-3-enamide (CID 87210952) is 2-formamidobut-3-enamide.
What is the SMILES notation for 2-formamidobut-3-enamide?
The canonical SMILES for 2-formamidobut-3-enamide is C=CC(NC=O)C(N)=O.
What is the InChIKey of 2-formamidobut-3-enamide?
The InChIKey is MRZANMVUSAZQDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-2-4(5(6)9)7-3-8/h2-4H,1H2,(H2,6,9)(H,7,8).
What are the key properties of 2-formamidobut-3-enamide?
2-formamidobut-3-enamide has a molecular weight of 128.13 g/mol, XLogP of -1.23, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formamidobut-3-enamide is sourced from PubChem (CID 87210952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).