C8H14N2O2S — CID 89101566
(E,2S)-2-formamido-7-sulfanylhept-4-enamide (PubChem CID 89101566) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is (E,2S)-2-formamido-7-sulfanylhept-4-enamide.
| Compound Name | (E,2S)-2-formamido-7-sulfanylhept-4-enamide |
|---|---|
| PubChem CID | 89101566 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (E,2S)-2-formamido-7-sulfanylhept-4-enamide |
| SMILES | NC(=O)[C@H](C/C=C/CCS)NC=O |
| InChI | InChI=1S/C8H14N2O2S/c9-8(12)7(10-6-11)4-2-1-3-5-13/h1-2,6-7,13H,3-5H2,(H2,9,12)(H,10,11)/b2-1+/t7-/m0/s1 |
| InChIKey | JIZVUJMYHSVUQM-HIXXPVPXSA-N |
| XLogP | -0.15 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|