C8H14N4O3 — CID 176519537
5-[(1-amino-2-oxoethenyl)amino]-2-formamidopentanamide (PubChem CID 176519537) has the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 5-[(1-amino-2-oxoethenyl)amino]-2-formamidopentanamide.
| Compound Name | 5-[(1-amino-2-oxoethenyl)amino]-2-formamidopentanamide |
|---|---|
| PubChem CID | 176519537 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 5-[(1-amino-2-oxoethenyl)amino]-2-formamidopentanamide |
| SMILES | NC(=O)C(CCCNC(N)=C=O)NC=O |
| InChI | InChI=1S/C8H14N4O3/c9-7(4-13)11-3-1-2-6(8(10)15)12-5-14/h5-6,11H,1-3,9H2,(H2,10,15)(H,12,14) |
| InChIKey | GFVKATXEYITYFD-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|