About acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane
acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane (PubChem CID 143839925) has the molecular formula C12H25N3O3
and a molecular weight of 259.35 g/mol. Its IUPAC name is acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane.
Molecular Properties
| Compound Name | acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane |
| PubChem CID | 143839925 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane |
| SMILES | C1CCCCC1.CC=O.NCC(NC=O)C(N)=O |
| InChI | InChI=1S/C6H12.C4H9N3O2.C2H4O/c1-2-4-6-5-3-1;5-1-3(4(6)9)7-2-8;1-2-3/h1-6H2;2-3H,1,5H2,(H2,6,9)(H,7,8);2H,1H3 |
| InChIKey | SKFBFMONIKKMOY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane?
The IUPAC name of acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane (CID 143839925) is acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane.
What is the SMILES notation for acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane?
The canonical SMILES for acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane is C1CCCCC1.CC=O.NCC(NC=O)C(N)=O.
What is the InChIKey of acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane?
The InChIKey is SKFBFMONIKKMOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.C4H9N3O2.C2H4O/c1-2-4-6-5-3-1;5-1-3(4(6)9)7-2-8;1-2-3/h1-6H2;2-3H,1,5H2,(H2,6,9)(H,7,8);2H,1H3.
What are the key properties of acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane?
acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane has a molecular weight of 259.35 g/mol, XLogP of 0.09, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;3-amino-2-formamidopropanamide;cyclohexane is sourced from PubChem (CID 143839925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).