C22H32O7 — CID 173345519
[5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 4-acetyloxybut-2-enoate (PubChem CID 173345519) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 4-acetyloxybut-2-enoate.
| Compound Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 4-acetyloxybut-2-enoate |
|---|---|
| PubChem CID | 173345519 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 4-acetyloxybut-2-enoate |
| SMILES | COC1C(OC(=O)C=CCOC(C)=O)CCC2(CO2)C1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C22H32O7/c1-14(2)8-9-17-21(4,29-17)20-19(25-5)16(10-11-22(20)13-27-22)28-18(24)7-6-12-26-15(3)23/h6-8,16-17,19-20H,9-13H2,1-5H3 |
| InChIKey | CIDAHARHEIMYOI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|