C24H31N2NaO4 — CID 173345969
sodium;N-(2,3-dihydro-1,4-benzodioxin-5-yl)-3-[4-[5-(dimethylamino)pentoxy]phenyl]prop-2-enamide;hydride (PubChem CID 173345969) has the molecular formula C24H31N2NaO4 and a molecular weight of 434.51 g/mol. Its IUPAC name is sodium;N-(2,3-dihydro-1,4-benzodioxin-5-yl)-3-[4-[5-(dimethylamino)pentoxy]phenyl]prop-2-enamide;hydride.
| Compound Name | sodium;N-(2,3-dihydro-1,4-benzodioxin-5-yl)-3-[4-[5-(dimethylamino)pentoxy]phenyl]prop-2-enamide;hydride |
|---|---|
| PubChem CID | 173345969 |
| Molecular Formula | C24H31N2NaO4 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | sodium;N-(2,3-dihydro-1,4-benzodioxin-5-yl)-3-[4-[5-(dimethylamino)pentoxy]phenyl]prop-2-enamide;hydride |
| SMILES | CN(C)CCCCCOc1ccc(C=CC(=O)Nc2cccc3c2OCCO3)cc1.[H-].[Na+] |
| InChI | InChI=1S/C24H30N2O4.Na.H/c1-26(2)15-4-3-5-16-28-20-12-9-19(10-13-20)11-14-23(27)25-21-7-6-8-22-24(21)30-18-17-29-22;;/h6-14H,3-5,15-18H2,1-2H3,(H,25,27);;/q;+1;-1 |
| InChIKey | DAQVRYLIKOLCPB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|