About 5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine
5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine (PubChem CID 173351958) has the molecular formula C7H8N4S
and a molecular weight of 180.24 g/mol. Its IUPAC name is 5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine.
Analyze 5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine?
The IUPAC name of 5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine (CID 173351958) is 5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine.
What is the SMILES notation for 5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine?
The canonical SMILES for 5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine is CSc1cc(C)nc2cnnn12.
What is the InChIKey of 5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine?
The InChIKey is FXOYDOZYYJJDEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4S/c1-5-3-7(12-2)11-6(9-5)4-8-10-11/h3-4H,1-2H3.
What are the key properties of 5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine?
5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine has a molecular weight of 180.24 g/mol, XLogP of 1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-7-methylsulfanyltriazolo[1,5-a]pyrimidine is sourced from PubChem (CID 173351958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).