C7H7F2NS2 — CID 91495772
3,5-difluoro-2,6-bis(methylsulfanyl)pyridine (PubChem CID 91495772) has the molecular formula C7H7F2NS2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3,5-difluoro-2,6-bis(methylsulfanyl)pyridine.
| Compound Name | 3,5-difluoro-2,6-bis(methylsulfanyl)pyridine |
|---|---|
| PubChem CID | 91495772 |
| Molecular Formula | C7H7F2NS2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.00 |
| IUPAC Name | 3,5-difluoro-2,6-bis(methylsulfanyl)pyridine |
| SMILES | CSc1nc(SC)c(F)cc1F |
| InChI | InChI=1S/C7H7F2NS2/c1-11-6-4(8)3-5(9)7(10-6)12-2/h3H,1-2H3 |
| InChIKey | ZXEAOWQSBAFRPK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |