C9H10N6O — CID 164890314
2-(5-methyltriazolo[5,1-b]purin-8-yl)ethanol (PubChem CID 164890314) has the molecular formula C9H10N6O and a molecular weight of 218.22 g/mol. Its IUPAC name is 2-(5-methyltriazolo[5,1-b]purin-8-yl)ethanol.
| Compound Name | 2-(5-methyltriazolo[5,1-b]purin-8-yl)ethanol |
|---|---|
| PubChem CID | 164890314 |
| Molecular Formula | C9H10N6O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-(5-methyltriazolo[5,1-b]purin-8-yl)ethanol |
| SMILES | Cc1nc2cnnn2c2c1ncn2CCO |
| InChI | InChI=1S/C9H10N6O/c1-6-8-9(14(2-3-16)5-10-8)15-7(12-6)4-11-13-15/h4-5,16H,2-3H2,1H3 |
| InChIKey | AMPOOBVQLZDUDF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |