C22H25N2NaO3 — CID 173352529
sodium;hydride;(Z)-6-[(2S,3R)-2-phenyl-1-(pyridine-3-carbonyl)pyrrolidin-3-yl]hex-4-enoic acid (PubChem CID 173352529) has the molecular formula C22H25N2NaO3 and a molecular weight of 388.44 g/mol. Its IUPAC name is sodium;hydride;(Z)-6-[(2S,3R)-2-phenyl-1-(pyridine-3-carbonyl)pyrrolidin-3-yl]hex-4-enoic acid.
| Compound Name | sodium;hydride;(Z)-6-[(2S,3R)-2-phenyl-1-(pyridine-3-carbonyl)pyrrolidin-3-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 173352529 |
| Molecular Formula | C22H25N2NaO3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | sodium;hydride;(Z)-6-[(2S,3R)-2-phenyl-1-(pyridine-3-carbonyl)pyrrolidin-3-yl]hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\C[C@@H]1CCN(C(=O)c2cccnc2)[C@@H]1c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C22H24N2O3.Na.H/c25-20(26)12-6-2-5-10-18-13-15-24(21(18)17-8-3-1-4-9-17)22(27)19-11-7-14-23-16-19;;/h1-5,7-9,11,14,16,18,21H,6,10,12-13,15H2,(H,25,26);;/q;+1;-1/b5-2-;;/t18-,21-;;/m1../s1 |
| InChIKey | PHLGTOGKJNRUBZ-USZCZXRVSA-N |
| XLogP | 1.21 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|