C18H22N10O5S3 — CID 173355488
(6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(1,4-diaminopyrimidin-1-ium-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173355488) has the molecular formula C18H22N10O5S3 and a molecular weight of 554.64 g/mol. Its IUPAC name is (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(1,4-diaminopyrimidin-1-ium-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(1,4-diaminopyrimidin-1-ium-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173355488 |
| Molecular Formula | C18H22N10O5S3 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-[(1,4-diaminopyrimidin-1-ium-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CCON=C(C(=O)NC1C(=O)N2CC(CSc3nc(N)cc[n+]3N)(C(=O)[O-])CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C18H22N10O5S3/c1-2-33-25-9(11-24-16(20)36-26-11)12(29)23-10-13(30)27-5-18(15(31)32,6-34-14(10)27)7-35-17-22-8(19)3-4-28(17)21/h3-4,10,14,19H,2,5-7,21H2,1H3,(H4,20,23,24,26,29,31,32)/t10?,14-,18?/m1/s1 |
| InChIKey | NLRVJJQHHMINHJ-MJFHRTCQSA-N |
| XLogP | -3.23 |
| TPSA | 231.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|