C21H16F3NO5S — CID 173356581
[2-[2-(4-methoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] 2,3,4-trifluorobenzenesulfonate (PubChem CID 173356581) has the molecular formula C21H16F3NO5S and a molecular weight of 451.42 g/mol. Its IUPAC name is [2-[2-(4-methoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] 2,3,4-trifluorobenzenesulfonate.
| Compound Name | [2-[2-(4-methoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] 2,3,4-trifluorobenzenesulfonate |
|---|---|
| PubChem CID | 173356581 |
| Molecular Formula | C21H16F3NO5S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | [2-[2-(4-methoxyphenyl)ethenyl]-4-methyl-6-oxo-1-pyridinyl] 2,3,4-trifluorobenzenesulfonate |
| SMILES | COc1ccc(C=Cc2cc(C)cc(=O)n2OS(=O)(=O)c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C21H16F3NO5S/c1-13-11-15(6-3-14-4-7-16(29-2)8-5-14)25(19(26)12-13)30-31(27,28)18-10-9-17(22)20(23)21(18)24/h3-12H,1-2H3 |
| InChIKey | RPHOGHCAMFRESH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|