C22H25N — CID 173357253
2,3-diethyl-4-(6-phenylhexa-1,3,5-trienyl)aniline (PubChem CID 173357253) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is 2,3-diethyl-4-(6-phenylhexa-1,3,5-trienyl)aniline.
| Compound Name | 2,3-diethyl-4-(6-phenylhexa-1,3,5-trienyl)aniline |
|---|---|
| PubChem CID | 173357253 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 2,3-diethyl-4-(6-phenylhexa-1,3,5-trienyl)aniline |
| SMILES | CCc1c(N)ccc(C=CC=CC=Cc2ccccc2)c1CC |
| InChI | InChI=1S/C22H25N/c1-3-20-19(16-17-22(23)21(20)4-2)15-11-6-5-8-12-18-13-9-7-10-14-18/h5-17H,3-4,23H2,1-2H3 |
| InChIKey | WVRLTEOMRIMVHV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|