C37H60N6O5 — CID 173357664
(2S)-6-amino-N-[(2S,5S,7R)-5,7-diamino-4,8-dicyclohexyl-5-formyl-3,6-dioxooctan-2-yl]-2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]hexanamide (PubChem CID 173357664) has the molecular formula C37H60N6O5 and a molecular weight of 668.92 g/mol. Its IUPAC name is (2S)-6-amino-N-[(2S,5S,7R)-5,7-diamino-4,8-dicyclohexyl-5-formyl-3,6-dioxooctan-2-yl]-2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-N-[(2S,5S,7R)-5,7-diamino-4,8-dicyclohexyl-5-formyl-3,6-dioxooctan-2-yl]-2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 173357664 |
| Molecular Formula | C37H60N6O5 |
| Molecular Weight | 668.92 g/mol |
| Exact Mass | 668.46 |
| IUPAC Name | (2S)-6-amino-N-[(2S,5S,7R)-5,7-diamino-4,8-dicyclohexyl-5-formyl-3,6-dioxooctan-2-yl]-2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]hexanamide |
| SMILES | CN[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)C(C1CCCCC1)[C@](N)(C=O)C(=O)[C@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C37H60N6O5/c1-25(42-35(47)30(20-12-13-21-38)43-36(48)31(41-2)23-27-16-8-4-9-17-27)33(45)32(28-18-10-5-11-19-28)37(40,24-44)34(46)29(39)22-26-14-6-3-7-15-26/h4,8-9,16-17,24-26,28-32,41H,3,5-7,10-15,18-23,38-40H2,1-2H3,(H,42,47)(H,43,48)/t25-,29+,30-,31-,32?,37+/m0/s1 |
| InChIKey | XPQOHXGUSVEEDT-BWKHQROISA-N |
| XLogP | 2.46 |
| TPSA | 199.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.92 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|