C12H13Cl — CID 173358036
2-chloro-4-prop-2-enyl-2,3-dihydro-1H-indene (PubChem CID 173358036) has the molecular formula C12H13Cl and a molecular weight of 192.69 g/mol. Its IUPAC name is 2-chloro-4-prop-2-enyl-2,3-dihydro-1H-indene.
| Compound Name | 2-chloro-4-prop-2-enyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 173358036 |
| Molecular Formula | C12H13Cl |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-chloro-4-prop-2-enyl-2,3-dihydro-1H-indene |
| SMILES | C=CCc1cccc2c1CC(Cl)C2 |
| InChI | InChI=1S/C12H13Cl/c1-2-4-9-5-3-6-10-7-11(13)8-12(9)10/h2-3,5-6,11H,1,4,7-8H2 |
| InChIKey | AMINIQVABVAMQG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|