C12H13BrN4S — CID 173359137
[cyano(3,4-dihydro-2H-isoquinolin-1-ylidene)methyl] carbamimidothioate;hydrobromide (PubChem CID 173359137) has the molecular formula C12H13BrN4S and a molecular weight of 325.24 g/mol. Its IUPAC name is [cyano(3,4-dihydro-2H-isoquinolin-1-ylidene)methyl] carbamimidothioate;hydrobromide.
| Compound Name | [cyano(3,4-dihydro-2H-isoquinolin-1-ylidene)methyl] carbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 173359137 |
| Molecular Formula | C12H13BrN4S |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | [cyano(3,4-dihydro-2H-isoquinolin-1-ylidene)methyl] carbamimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SC(C#N)=C1NCCc2ccccc21 |
| InChI | InChI=1S/C12H12N4S.BrH/c13-7-10(17-12(14)15)11-9-4-2-1-3-8(9)5-6-16-11;/h1-4,16H,5-6H2,(H3,14,15);1H |
| InChIKey | YGNXGSVBMIAWAM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|