C12H12N4S — CID 67859147
[(E)-cyano(3,4-dihydro-2H-isoquinolin-1-ylidene)methyl] carbamimidothioate (PubChem CID 67859147) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is [(E)-cyano(3,4-dihydro-2H-isoquinolin-1-ylidene)methyl] carbamimidothioate.
| Compound Name | [(E)-cyano(3,4-dihydro-2H-isoquinolin-1-ylidene)methyl] carbamimidothioate |
|---|---|
| PubChem CID | 67859147 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | [(E)-cyano(3,4-dihydro-2H-isoquinolin-1-ylidene)methyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)S/C(C#N)=C1/NCCc2ccccc21 |
| InChI | InChI=1S/C12H12N4S/c13-7-10(17-12(14)15)11-9-4-2-1-3-8(9)5-6-16-11/h1-4,16H,5-6H2,(H3,14,15)/b11-10+ |
| InChIKey | NZSIZHFLZRDNNR-ZHACJKMWSA-N |
| XLogP | 1.65 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|