C13H11N3 — CID 51414336
2-[(3S)-3-methyl-3,4-dihydro-2H-isoquinolin-1-ylidene]propanedinitrile (PubChem CID 51414336) has the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-[(3S)-3-methyl-3,4-dihydro-2H-isoquinolin-1-ylidene]propanedinitrile.
| Compound Name | 2-[(3S)-3-methyl-3,4-dihydro-2H-isoquinolin-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 51414336 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-[(3S)-3-methyl-3,4-dihydro-2H-isoquinolin-1-ylidene]propanedinitrile |
| SMILES | C[C@H]1Cc2ccccc2C(=C(C#N)C#N)N1 |
| InChI | InChI=1S/C13H11N3/c1-9-6-10-4-2-3-5-12(10)13(16-9)11(7-14)8-15/h2-5,9,16H,6H2,1H3/t9-/m0/s1 |
| InChIKey | AWHXSRUOTIOLLO-VIFPVBQESA-N |
| XLogP | 1.98 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|