C11H10N2 — CID 5099364
2-(3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile (PubChem CID 5099364) has the molecular formula C11H10N2 and a molecular weight of 170.22 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile.
| Compound Name | 2-(3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile |
|---|---|
| PubChem CID | 5099364 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2-(3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile |
| SMILES | N#CC=C1NCCc2ccccc21 |
| InChI | InChI=1S/C11H10N2/c12-7-5-11-10-4-2-1-3-9(10)6-8-13-11/h1-5,13H,6,8H2 |
| InChIKey | LHYRDJGSLCDNHX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|