C13H17N3S — CID 2879571
(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)methyl carbamimidothioate (PubChem CID 2879571) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is (3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)methyl carbamimidothioate.
| Compound Name | (3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)methyl carbamimidothioate |
|---|---|
| PubChem CID | 2879571 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SC=C1NC(C)(C)Cc2ccccc21 |
| InChI | InChI=1S/C13H17N3S/c1-13(2)7-9-5-3-4-6-10(9)11(16-13)8-17-12(14)15/h3-6,8,16H,7H2,1-2H3,(H3,14,15) |
| InChIKey | RKYSHDIYKYNOQB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|