About (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane
(4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane (PubChem CID 173363125) has the molecular formula C19H28O5Si2
and a molecular weight of 392.60 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane.
Molecular Properties
| Compound Name | (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane |
| PubChem CID | 173363125 |
| Molecular Formula | C19H28O5Si2 |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(OC)cc2)cc1.C[SiH2]O[SiH3] |
| InChI | InChI=1S/C18H20O4.CH8OSi2/c1-3-4-13-21-16-7-5-14(6-8-16)18(19)22-17-11-9-15(20-2)10-12-17;1-4-2-3/h5-12H,3-4,13H2,1-2H3;4H2,1,3H3 |
| InChIKey | RDNPAKBMAZBULF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane?
The IUPAC name of (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane (CID 173363125) is (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane.
What is the SMILES notation for (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane?
The canonical SMILES for (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane is CCCCOc1ccc(C(=O)Oc2ccc(OC)cc2)cc1.C[SiH2]O[SiH3].
What is the InChIKey of (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane?
The InChIKey is RDNPAKBMAZBULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O4.CH8OSi2/c1-3-4-13-21-16-7-5-14(6-8-16)18(19)22-17-11-9-15(20-2)10-12-17;1-4-2-3/h5-12H,3-4,13H2,1-2H3;4H2,1,3H3.
What are the key properties of (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane?
(4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane has a molecular weight of 392.60 g/mol, XLogP of 2.51, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) 4-butoxybenzoate;methyl(silyloxy)silane is sourced from PubChem (CID 173363125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).