C9H12ClNaO5S — CID 173365273
sodium;3-chloro-2-(2-methoxyethoxy)benzenesulfonic acid;hydride (PubChem CID 173365273) has the molecular formula C9H12ClNaO5S and a molecular weight of 290.70 g/mol. Its IUPAC name is sodium;3-chloro-2-(2-methoxyethoxy)benzenesulfonic acid;hydride.
| Compound Name | sodium;3-chloro-2-(2-methoxyethoxy)benzenesulfonic acid;hydride |
|---|---|
| PubChem CID | 173365273 |
| Molecular Formula | C9H12ClNaO5S |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | sodium;3-chloro-2-(2-methoxyethoxy)benzenesulfonic acid;hydride |
| SMILES | COCCOc1c(Cl)cccc1S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C9H11ClO5S.Na.H/c1-14-5-6-15-9-7(10)3-2-4-8(9)16(11,12)13;;/h2-4H,5-6H2,1H3,(H,11,12,13);;/q;+1;-1 |
| InChIKey | CNGZYTQNNOKHSP-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|